C30H34O3 — CID 67796858
methyl (Z)-7-[(5R)-5-[(E)-3-oxo-4-phenylpent-1-enyl]-4-phenylcyclopenten-1-yl]hept-5-enoate (PubChem CID 67796858) has the molecular formula C30H34O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is methyl (Z)-7-[(5R)-5-[(E)-3-oxo-4-phenylpent-1-enyl]-4-phenylcyclopenten-1-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(5R)-5-[(E)-3-oxo-4-phenylpent-1-enyl]-4-phenylcyclopenten-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 67796858 |
| Molecular Formula | C30H34O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | methyl (Z)-7-[(5R)-5-[(E)-3-oxo-4-phenylpent-1-enyl]-4-phenylcyclopenten-1-yl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\CC1=CCC(c2ccccc2)[C@H]1/C=C/C(=O)C(C)c1ccccc1 |
| InChI | InChI=1S/C30H34O3/c1-23(24-13-8-5-9-14-24)29(31)22-21-28-26(17-7-3-4-12-18-30(32)33-2)19-20-27(28)25-15-10-6-11-16-25/h3,5-11,13-16,19,21-23,27-28H,4,12,17-18,20H2,1-2H3/b7-3-,22-21+/t23?,27?,28-/m0/s1 |
| InChIKey | XJKJCISFMXNNJZ-HMUMCRAVSA-N |
| XLogP | 6.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|