C18H28N5O4Si — CID 67799447
CID 67799447 (PubChem CID 67799447) has the molecular formula C18H28N5O4Si and a molecular weight of 406.54 g/mol.
| Compound Name | CID 67799447 |
|---|---|
| PubChem CID | 67799447 |
| Molecular Formula | C18H28N5O4Si |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | — |
| SMILES | C[Si](C)[C@]1(n2cnc3c(N)ncnc32)C[C@H](OC(C)(C)C)[C@@H](CCC(=O)O)O1 |
| InChI | InChI=1S/C18H28N5O4Si/c1-17(2,3)26-12-8-18(28(4)5,27-11(12)6-7-13(24)25)23-10-22-14-15(19)20-9-21-16(14)23/h9-12H,6-8H2,1-5H3,(H,24,25)(H2,19,20,21)/t11-,12+,18+/m1/s1 |
| InChIKey | RQHSDDQRQGRECH-SOZUMNATSA-N |
| XLogP | 2.19 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|