C18H31O6P — CID 67818398
butane;[3-methoxy-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;phosphenous acid (PubChem CID 67818398) has the molecular formula C18H31O6P and a molecular weight of 374.41 g/mol. Its IUPAC name is butane;[3-methoxy-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;phosphenous acid.
| Compound Name | butane;[3-methoxy-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;phosphenous acid |
|---|---|
| PubChem CID | 67818398 |
| Molecular Formula | C18H31O6P |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | butane;[3-methoxy-5-(methoxymethyl)phenyl] 2,2-dimethylpropanoate;phosphenous acid |
| SMILES | CCCC.COCc1cc(OC)cc(OC(=O)C(C)(C)C)c1.O=PO |
| InChI | InChI=1S/C14H20O4.C4H10.HO2P/c1-14(2,3)13(15)18-12-7-10(9-16-4)6-11(8-12)17-5;1-3-4-2;1-3-2/h6-8H,9H2,1-5H3;3-4H2,1-2H3;(H,1,2) |
| InChIKey | GSEQNXORJAZUSH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|