C27H35N5O4 — CID 67852842
3-[4-[[4-(N-benzyl-4-carbamimidoylanilino)-4-oxobutanoyl]amino]butylamino]pent-4-enoic acid (PubChem CID 67852842) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is 3-[4-[[4-(N-benzyl-4-carbamimidoylanilino)-4-oxobutanoyl]amino]butylamino]pent-4-enoic acid.
| Compound Name | 3-[4-[[4-(N-benzyl-4-carbamimidoylanilino)-4-oxobutanoyl]amino]butylamino]pent-4-enoic acid |
|---|---|
| PubChem CID | 67852842 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 3-[4-[[4-(N-benzyl-4-carbamimidoylanilino)-4-oxobutanoyl]amino]butylamino]pent-4-enoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N(Cc2ccccc2)C(=O)CCC(=O)NCCCCNC(C=C)CC(=O)O)cc1 |
| InChI | InChI=1S/C27H35N5O4/c1-2-22(18-26(35)36)30-16-6-7-17-31-24(33)14-15-25(34)32(19-20-8-4-3-5-9-20)23-12-10-21(11-13-23)27(28)29/h2-5,8-13,22,30H,1,6-7,14-19H2,(H3,28,29)(H,31,33)(H,35,36) |
| InChIKey | JZPDTXCHDNZXKE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|