C11H17N3O6S — CID 67866584
4-[(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-3-methylbutanoic acid (PubChem CID 67866584) has the molecular formula C11H17N3O6S and a molecular weight of 319.34 g/mol. Its IUPAC name is 4-[(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-3-methylbutanoic acid.
| Compound Name | 4-[(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 67866584 |
| Molecular Formula | C11H17N3O6S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-[(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-3-methylbutanoic acid |
| SMILES | COc1cc(OC)nc(NS(=O)(=O)CC(C)CC(=O)O)n1 |
| InChI | InChI=1S/C11H17N3O6S/c1-7(4-10(15)16)6-21(17,18)14-11-12-8(19-2)5-9(13-11)20-3/h5,7H,4,6H2,1-3H3,(H,15,16)(H,12,13,14) |
| InChIKey | AFIOOWKGZAYLFK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |