C14H14O6 — CID 67877936
2-[4-(4-oxo-1,3-dioxan-2-yl)phenyl]-1,3-dioxan-4-one (PubChem CID 67877936) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-[4-(4-oxo-1,3-dioxan-2-yl)phenyl]-1,3-dioxan-4-one.
| Compound Name | 2-[4-(4-oxo-1,3-dioxan-2-yl)phenyl]-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 67877936 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-[4-(4-oxo-1,3-dioxan-2-yl)phenyl]-1,3-dioxan-4-one |
| SMILES | O=C1CCOC(c2ccc(C3OCCC(=O)O3)cc2)O1 |
| InChI | InChI=1S/C14H14O6/c15-11-5-7-17-13(19-11)9-1-2-10(4-3-9)14-18-8-6-12(16)20-14/h1-4,13-14H,5-8H2 |
| InChIKey | JHJBJZUVIAOJND-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |