C22H31O3PSi — CID 67903687
2,2-dimethyl-1-[[methyl(diphenyl)silyl]oxy-(2-methylpropyl)phosphoryl]propan-1-one (PubChem CID 67903687) has the molecular formula C22H31O3PSi and a molecular weight of 402.55 g/mol. Its IUPAC name is 2,2-dimethyl-1-[[methyl(diphenyl)silyl]oxy-(2-methylpropyl)phosphoryl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[[methyl(diphenyl)silyl]oxy-(2-methylpropyl)phosphoryl]propan-1-one |
|---|---|
| PubChem CID | 67903687 |
| Molecular Formula | C22H31O3PSi |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2,2-dimethyl-1-[[methyl(diphenyl)silyl]oxy-(2-methylpropyl)phosphoryl]propan-1-one |
| SMILES | CC(C)CP(=O)(O[Si](C)(c1ccccc1)c1ccccc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C22H31O3PSi/c1-18(2)17-26(24,21(23)22(3,4)5)25-27(6,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18H,17H2,1-6H3 |
| InChIKey | COTHZTMNMQKFOA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|