About benzo[k]phenanthridine;isoquinoline
benzo[k]phenanthridine;isoquinoline (PubChem CID 67914193) has the molecular formula C26H18N2
and a molecular weight of 358.44 g/mol. Its IUPAC name is benzo[k]phenanthridine;isoquinoline.
Molecular Properties
| Compound Name | benzo[k]phenanthridine;isoquinoline |
| PubChem CID | 67914193 |
| Molecular Formula | C26H18N2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | benzo[k]phenanthridine;isoquinoline |
| SMILES | c1ccc2c(c1)ccc1cnc3ccccc3c12.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C17H11N.C9H7N/c1-2-6-14-12(5-1)9-10-13-11-18-16-8-4-3-7-15(16)17(13)14;1-2-4-9-7-10-6-5-8(9)3-1/h1-11H;1-7H |
| InChIKey | LOAQRYJNIQZQQB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[k]phenanthridine;isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[k]phenanthridine;isoquinoline?
The IUPAC name of benzo[k]phenanthridine;isoquinoline (CID 67914193) is benzo[k]phenanthridine;isoquinoline.
What is the SMILES notation for benzo[k]phenanthridine;isoquinoline?
The canonical SMILES for benzo[k]phenanthridine;isoquinoline is c1ccc2c(c1)ccc1cnc3ccccc3c12.c1ccc2cnccc2c1.
What is the InChIKey of benzo[k]phenanthridine;isoquinoline?
The InChIKey is LOAQRYJNIQZQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N.C9H7N/c1-2-6-14-12(5-1)9-10-13-11-18-16-8-4-3-7-15(16)17(13)14;1-2-4-9-7-10-6-5-8(9)3-1/h1-11H;1-7H.
What are the key properties of benzo[k]phenanthridine;isoquinoline?
benzo[k]phenanthridine;isoquinoline has a molecular weight of 358.44 g/mol, XLogP of 6.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[k]phenanthridine;isoquinoline is sourced from PubChem (CID 67914193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).