C33H60N2O3 — CID 67920839
adamantan-1-amine;(3R)-3-(hexadec-9-enoylamino)-5-methylhexanoic acid (PubChem CID 67920839) has the molecular formula C33H60N2O3 and a molecular weight of 532.85 g/mol. Its IUPAC name is adamantan-1-amine;(3R)-3-(hexadec-9-enoylamino)-5-methylhexanoic acid.
| Compound Name | adamantan-1-amine;(3R)-3-(hexadec-9-enoylamino)-5-methylhexanoic acid |
|---|---|
| PubChem CID | 67920839 |
| Molecular Formula | C33H60N2O3 |
| Molecular Weight | 532.85 g/mol |
| Exact Mass | 532.46 |
| IUPAC Name | adamantan-1-amine;(3R)-3-(hexadec-9-enoylamino)-5-methylhexanoic acid |
| SMILES | CCCCCCC=CCCCCCCCC(=O)N[C@@H](CC(=O)O)CC(C)C.NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H43NO3.C10H17N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(25)24-21(18-20(2)3)19-23(26)27;11-10-4-7-1-8(5-10)3-9(2-7)6-10/h9-10,20-21H,4-8,11-19H2,1-3H3,(H,24,25)(H,26,27);7-9H,1-6,11H2/t21-;/m1./s1 |
| InChIKey | QEQRXBNYMYBRMN-ZMBIFBSDSA-N |
| XLogP | 8.16 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.85 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|