C22H31FS — CID 67933325
(8S,10R,13S,14S)-3-(fluoromethylidene)-13-methyl-10-(2-methylsulfanylethyl)-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 67933325) has the molecular formula C22H31FS and a molecular weight of 346.56 g/mol. Its IUPAC name is (8S,10R,13S,14S)-3-(fluoromethylidene)-13-methyl-10-(2-methylsulfanylethyl)-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,10R,13S,14S)-3-(fluoromethylidene)-13-methyl-10-(2-methylsulfanylethyl)-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 67933325 |
| Molecular Formula | C22H31FS |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (8S,10R,13S,14S)-3-(fluoromethylidene)-13-methyl-10-(2-methylsulfanylethyl)-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CSCC[C@]12CCC(=CF)C=C1CC[C@@H]1C2=CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C22H31FS/c1-21-9-3-4-19(21)18-6-5-17-14-16(15-23)7-11-22(17,12-13-24-2)20(18)8-10-21/h8,14-15,18-19H,3-7,9-13H2,1-2H3/t18-,19-,21-,22+/m0/s1 |
| InChIKey | DGBMJWUHEDABCO-BLKABHOGSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|