C24H38O7 — CID 67937848
(3R,4aR,5S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-6-(oxolan-2-yloxy)-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-1-one (PubChem CID 67937848) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is (3R,4aR,5S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-6-(oxolan-2-yloxy)-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-1-one.
| Compound Name | (3R,4aR,5S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-6-(oxolan-2-yloxy)-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-1-one |
|---|---|
| PubChem CID | 67937848 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (3R,4aR,5S,6aS,10S,10aR,10bS)-3-ethenyl-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-6-(oxolan-2-yloxy)-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-1-one |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3C(OC3CCCO3)[C@H](O)[C@@]2(C)O1 |
| InChI | InChI=1S/C24H38O7/c1-7-21(4)13-15(26)24(28)22(5)14(25)10-11-20(2,3)18(22)17(19(27)23(24,6)31-21)30-16-9-8-12-29-16/h7,14,16-19,25,27-28H,1,8-13H2,2-6H3/t14-,16?,17?,18-,19-,21-,22-,23+,24-/m0/s1 |
| InChIKey | KHMVXUNLSZSTLW-OTRPOGGOSA-N |
| XLogP | 2.11 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|