C18H17N3O2 — CID 679881
2-[(3,4-dihydro-2H-quinolin-1-ylamino)methyl]isoindole-1,3-dione (PubChem CID 679881) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[(3,4-dihydro-2H-quinolin-1-ylamino)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(3,4-dihydro-2H-quinolin-1-ylamino)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 679881 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-[(3,4-dihydro-2H-quinolin-1-ylamino)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CNN1CCCc2ccccc21 |
| InChI | InChI=1S/C18H17N3O2/c22-17-14-8-2-3-9-15(14)18(23)20(17)12-19-21-11-5-7-13-6-1-4-10-16(13)21/h1-4,6,8-10,19H,5,7,11-12H2 |
| InChIKey | DNCYETGPKPZZQS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|