C43H46F2N4O3S2Si — CID 68503233
tert-butyl 2-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate (PubChem CID 68503233) has the molecular formula C43H46F2N4O3S2Si and a molecular weight of 797.08 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 68503233 |
| Molecular Formula | C43H46F2N4O3S2Si |
| Molecular Weight | 797.08 g/mol |
| Exact Mass | 796.27 |
| IUPAC Name | tert-butyl 2-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-(2,5-difluorophenyl)-2-phenyl-1,3,4-thiadiazol-3-yl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2nc(N3N=C(c4cc(F)ccc4F)SC3(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c3ccccc3)sc2C1 |
| InChI | InChI=1S/C43H46F2N4O3S2Si/c1-41(2,3)52-40(50)48-26-24-36-37(29-48)53-39(46-36)49-43(30-16-10-7-11-17-30,54-38(47-49)34-28-31(44)22-23-35(34)45)25-27-51-55(42(4,5)6,32-18-12-8-13-19-32)33-20-14-9-15-21-33/h7-23,28H,24-27,29H2,1-6H3 |
| InChIKey | CENMLFXWXKGJOM-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 67.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.08 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|