C22H20F2N4OS2 — CID 59463930
2-[5-(2,5-difluorophenyl)-2-phenyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1,3,4-thiadiazol-2-yl]ethanol (PubChem CID 59463930) has the molecular formula C22H20F2N4OS2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[5-(2,5-difluorophenyl)-2-phenyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1,3,4-thiadiazol-2-yl]ethanol.
| Compound Name | 2-[5-(2,5-difluorophenyl)-2-phenyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1,3,4-thiadiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 59463930 |
| Molecular Formula | C22H20F2N4OS2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 2-[5-(2,5-difluorophenyl)-2-phenyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1,3,4-thiadiazol-2-yl]ethanol |
| SMILES | OCCC1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1c1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C22H20F2N4OS2/c23-15-6-7-17(24)16(12-15)20-27-28(21-26-18-8-10-25-13-19(18)30-21)22(31-20,9-11-29)14-4-2-1-3-5-14/h1-7,12,25,29H,8-11,13H2 |
| InChIKey | LXPFVZSELSJTHX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |