C24H28N2O3 — CID 68543344
tert-butyl 1-benzyl-2-oxospiro[indole-3,4'-piperidine]-5-carboxylate (PubChem CID 68543344) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is tert-butyl 1-benzyl-2-oxospiro[indole-3,4'-piperidine]-5-carboxylate.
| Compound Name | tert-butyl 1-benzyl-2-oxospiro[indole-3,4'-piperidine]-5-carboxylate |
|---|---|
| PubChem CID | 68543344 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | tert-butyl 1-benzyl-2-oxospiro[indole-3,4'-piperidine]-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc2c(c1)C1(CCNCC1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C24H28N2O3/c1-23(2,3)29-21(27)18-9-10-20-19(15-18)24(11-13-25-14-12-24)22(28)26(20)16-17-7-5-4-6-8-17/h4-10,15,25H,11-14,16H2,1-3H3 |
| InChIKey | MGSFJXOVPZAECK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |