C19H17N3O4S — CID 68544111
(Z)-but-2-enedioic acid;N'-(2-phenyl-1,3-benzothiazol-6-yl)ethanimidamide (PubChem CID 68544111) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N'-(2-phenyl-1,3-benzothiazol-6-yl)ethanimidamide.
| Compound Name | (Z)-but-2-enedioic acid;N'-(2-phenyl-1,3-benzothiazol-6-yl)ethanimidamide |
|---|---|
| PubChem CID | 68544111 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | (Z)-but-2-enedioic acid;N'-(2-phenyl-1,3-benzothiazol-6-yl)ethanimidamide |
| SMILES | C/C(N)=N\c1ccc2nc(-c3ccccc3)sc2c1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C15H13N3S.C4H4O4/c1-10(16)17-12-7-8-13-14(9-12)19-15(18-13)11-5-3-2-4-6-11;5-3(6)1-2-4(7)8/h2-9H,1H3,(H2,16,17);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | DCSNOZIBIPLYKP-BTJKTKAUSA-N |
| XLogP | 3.68 |
| TPSA | 125.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|