C12H15N3O — CID 68580786
1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl(pyridin-3-yl)methanone (PubChem CID 68580786) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl(pyridin-3-yl)methanone.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl(pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 68580786 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrol-4-yl(pyridin-3-yl)methanone |
| SMILES | O=C(c1cccnc1)C1NCC2CNCC21 |
| InChI | InChI=1S/C12H15N3O/c16-12(8-2-1-3-13-4-8)11-10-7-14-5-9(10)6-15-11/h1-4,9-11,14-15H,5-7H2 |
| InChIKey | UWFXCEHXXVFYJU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |