C49H45FO7S — CID 68587621
(2S,3R,4S,5R,6R)-2-[3-[1-benzothiophen-2-yl(hydroxy)methyl]-4-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 68587621) has the molecular formula C49H45FO7S and a molecular weight of 796.96 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[3-[1-benzothiophen-2-yl(hydroxy)methyl]-4-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[3-[1-benzothiophen-2-yl(hydroxy)methyl]-4-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 68587621 |
| Molecular Formula | C49H45FO7S |
| Molecular Weight | 796.96 g/mol |
| Exact Mass | 796.29 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[3-[1-benzothiophen-2-yl(hydroxy)methyl]-4-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | OC(c1cc2ccccc2s1)c1cc([C@]2(O)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)ccc1F |
| InChI | InChI=1S/C49H45FO7S/c50-41-26-25-39(28-40(41)45(51)44-27-38-23-13-14-24-43(38)58-44)49(52)48(56-32-37-21-11-4-12-22-37)47(55-31-36-19-9-3-10-20-36)46(54-30-35-17-7-2-8-18-35)42(57-49)33-53-29-34-15-5-1-6-16-34/h1-28,42,45-48,51-52H,29-33H2/t42-,45?,46-,47+,48-,49+/m1/s1 |
| InChIKey | KOBIODGLPQUMGA-FMXDZKJKSA-N |
| XLogP | 9.64 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.96 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |