C21H27F3N8O — CID 68602637
1,1-diethyl-3-[3-[[2-[(1-methylindazol-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]urea (PubChem CID 68602637) has the molecular formula C21H27F3N8O and a molecular weight of 464.50 g/mol. Its IUPAC name is 1,1-diethyl-3-[3-[[2-[(1-methylindazol-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]urea.
| Compound Name | 1,1-diethyl-3-[3-[[2-[(1-methylindazol-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]urea |
|---|---|
| PubChem CID | 68602637 |
| Molecular Formula | C21H27F3N8O |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 1,1-diethyl-3-[3-[[2-[(1-methylindazol-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]urea |
| SMILES | CCN(CC)C(=O)NCCCNc1nc(Nc2ccc3cnn(C)c3c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C21H27F3N8O/c1-4-32(5-2)20(33)26-10-6-9-25-18-16(21(22,23)24)13-27-19(30-18)29-15-8-7-14-12-28-31(3)17(14)11-15/h7-8,11-13H,4-6,9-10H2,1-3H3,(H,26,33)(H2,25,27,29,30) |
| InChIKey | OYYHFEVYRHDRPO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|