C33H64O12 — CID 68636934
(2R,3S,4S,5R)-5-(2,3-dihydroxypropoxy)-5,6-bis(2,3-dihydroxypropyl)-2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxane-3,4-diol (PubChem CID 68636934) has the molecular formula C33H64O12 and a molecular weight of 652.86 g/mol. Its IUPAC name is (2R,3S,4S,5R)-5-(2,3-dihydroxypropoxy)-5,6-bis(2,3-dihydroxypropyl)-2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-5-(2,3-dihydroxypropoxy)-5,6-bis(2,3-dihydroxypropyl)-2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 68636934 |
| Molecular Formula | C33H64O12 |
| Molecular Weight | 652.86 g/mol |
| Exact Mass | 652.44 |
| IUPAC Name | (2R,3S,4S,5R)-5-(2,3-dihydroxypropoxy)-5,6-bis(2,3-dihydroxypropyl)-2-(hydroxymethyl)-6-[(Z)-octadec-9-enoxy]oxane-3,4-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC1(CC(O)CO)O[C@H](CO)[C@@H](O)[C@H](O)[C@@]1(CC(O)CO)OCC(O)CO |
| InChI | InChI=1S/C33H64O12/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-43-33(20-27(39)22-35)32(19-26(38)21-34,44-25-28(40)23-36)31(42)30(41)29(24-37)45-33/h9-10,26-31,34-42H,2-8,11-25H2,1H3/b10-9-/t26?,27?,28?,29-,30-,31+,32-,33?/m1/s1 |
| InChIKey | HYQMGSSEUNTDLK-XGMVJEFISA-N |
| XLogP | 1.44 |
| TPSA | 209.76 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.86 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|