C33H33NO7 — CID 68637050
(4-nitrophenyl) 4-[[2,3-bis(4-methoxyphenyl)phenyl]methoxy]hexanoate (PubChem CID 68637050) has the molecular formula C33H33NO7 and a molecular weight of 555.63 g/mol. Its IUPAC name is (4-nitrophenyl) 4-[[2,3-bis(4-methoxyphenyl)phenyl]methoxy]hexanoate.
| Compound Name | (4-nitrophenyl) 4-[[2,3-bis(4-methoxyphenyl)phenyl]methoxy]hexanoate |
|---|---|
| PubChem CID | 68637050 |
| Molecular Formula | C33H33NO7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | (4-nitrophenyl) 4-[[2,3-bis(4-methoxyphenyl)phenyl]methoxy]hexanoate |
| SMILES | CCC(CCC(=O)Oc1ccc([N+](=O)[O-])cc1)OCc1cccc(-c2ccc(OC)cc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H33NO7/c1-4-27(20-21-32(35)41-30-18-12-26(13-19-30)34(36)37)40-22-25-6-5-7-31(23-8-14-28(38-2)15-9-23)33(25)24-10-16-29(39-3)17-11-24/h5-19,27H,4,20-22H2,1-3H3 |
| InChIKey | WANWPJNJAZOVAA-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|