C33H39N5O4S — CID 68673724
1-ethyl-3,3,5-trimethyl-7-[3-[2-(4-methyl-7-oxothieno[2,3-c]pyridin-6-yl)ethyl-(pyridin-4-ylmethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione (PubChem CID 68673724) has the molecular formula C33H39N5O4S and a molecular weight of 601.77 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[3-[2-(4-methyl-7-oxothieno[2,3-c]pyridin-6-yl)ethyl-(pyridin-4-ylmethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[3-[2-(4-methyl-7-oxothieno[2,3-c]pyridin-6-yl)ethyl-(pyridin-4-ylmethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 68673724 |
| Molecular Formula | C33H39N5O4S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[3-[2-(4-methyl-7-oxothieno[2,3-c]pyridin-6-yl)ethyl-(pyridin-4-ylmethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCN(CCn3cc(C)c4ccsc4c3=O)Cc3ccncc3)ccc21 |
| InChI | InChI=1S/C33H39N5O4S/c1-6-38-27-9-8-25(20-28(27)35(5)31(40)33(3,4)32(38)41)42-18-7-15-36(22-24-10-13-34-14-11-24)16-17-37-21-23(2)26-12-19-43-29(26)30(37)39/h8-14,19-21H,6-7,15-18,22H2,1-5H3 |
| InChIKey | DKFFNHJGTAIBAX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 87.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|