C23H28N2O6 — CID 68675076
1-[5,7-dimethoxy-4-(4-methoxyphenyl)-2,2,4-trimethyl-6-nitro-3H-quinolin-1-yl]ethanone (PubChem CID 68675076) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is 1-[5,7-dimethoxy-4-(4-methoxyphenyl)-2,2,4-trimethyl-6-nitro-3H-quinolin-1-yl]ethanone.
| Compound Name | 1-[5,7-dimethoxy-4-(4-methoxyphenyl)-2,2,4-trimethyl-6-nitro-3H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 68675076 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-[5,7-dimethoxy-4-(4-methoxyphenyl)-2,2,4-trimethyl-6-nitro-3H-quinolin-1-yl]ethanone |
| SMILES | COc1ccc(C2(C)CC(C)(C)N(C(C)=O)c3cc(OC)c([N+](=O)[O-])c(OC)c32)cc1 |
| InChI | InChI=1S/C23H28N2O6/c1-14(26)24-17-12-18(30-6)20(25(27)28)21(31-7)19(17)23(4,13-22(24,2)3)15-8-10-16(29-5)11-9-15/h8-12H,13H2,1-7H3 |
| InChIKey | LFAOVNADYCDTKA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|