C11H10N4OS — CID 68711619
5-(2,1,3-benzothiadiazol-5-yl)-1,2-dimethylpyrazol-3-one (PubChem CID 68711619) has the molecular formula C11H10N4OS and a molecular weight of 246.30 g/mol. Its IUPAC name is 5-(2,1,3-benzothiadiazol-5-yl)-1,2-dimethylpyrazol-3-one.
| Compound Name | 5-(2,1,3-benzothiadiazol-5-yl)-1,2-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 68711619 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 5-(2,1,3-benzothiadiazol-5-yl)-1,2-dimethylpyrazol-3-one |
| SMILES | Cn1c(-c2ccc3nsnc3c2)cc(=O)n1C |
| InChI | InChI=1S/C11H10N4OS/c1-14-10(6-11(16)15(14)2)7-3-4-8-9(5-7)13-17-12-8/h3-6H,1-2H3 |
| InChIKey | UKPUGYUDIOGVRD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |