C19H32O6 — CID 68715818
2-[2-(1,1-dicyclopentyloxyethoxy)ethoxy]ethyl prop-2-enoate (PubChem CID 68715818) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-[2-(1,1-dicyclopentyloxyethoxy)ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-(1,1-dicyclopentyloxyethoxy)ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 68715818 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-[2-(1,1-dicyclopentyloxyethoxy)ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOC(C)(OC1CCCC1)OC1CCCC1 |
| InChI | InChI=1S/C19H32O6/c1-3-18(20)22-14-12-21-13-15-23-19(2,24-16-8-4-5-9-16)25-17-10-6-7-11-17/h3,16-17H,1,4-15H2,2H3 |
| InChIKey | VOOWGKKPXBKPBJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|