C17H11ClIN3O — CID 68790188
(2'S,3R)-5-chloro-2'-(3-iodo-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 68790188) has the molecular formula C17H11ClIN3O and a molecular weight of 435.65 g/mol. Its IUPAC name is (2'S,3R)-5-chloro-2'-(3-iodo-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | (2'S,3R)-5-chloro-2'-(3-iodo-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 68790188 |
| Molecular Formula | C17H11ClIN3O |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | (2'S,3R)-5-chloro-2'-(3-iodo-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2[C@]12C[C@H]2c1ccc2c(I)[nH]nc2c1 |
| InChI | InChI=1S/C17H11ClIN3O/c18-9-2-4-13-11(6-9)17(16(23)20-13)7-12(17)8-1-3-10-14(5-8)21-22-15(10)19/h1-6,12H,7H2,(H,20,23)(H,21,22)/t12-,17-/m0/s1 |
| InChIKey | MDARCZYYSBNSFK-SJCJKPOMSA-N |
| XLogP | 4.20 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|