C22H27Cl2N3O5S — CID 68802543
2,4-dichloro-N-[2-[2-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-oxoethoxy]ethyl]-N,6-dimethylbenzenesulfonamide (PubChem CID 68802543) has the molecular formula C22H27Cl2N3O5S and a molecular weight of 516.45 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[2-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-oxoethoxy]ethyl]-N,6-dimethylbenzenesulfonamide.
| Compound Name | 2,4-dichloro-N-[2-[2-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-oxoethoxy]ethyl]-N,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 68802543 |
| Molecular Formula | C22H27Cl2N3O5S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 2,4-dichloro-N-[2-[2-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-oxoethoxy]ethyl]-N,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)cc(Cl)c1S(=O)(=O)N(C)CCOCC(=O)N1CCC(O)(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H27Cl2N3O5S/c1-16-13-17(23)14-18(24)21(16)33(30,31)26(2)11-12-32-15-20(28)27-9-6-22(29,7-10-27)19-5-3-4-8-25-19/h3-5,8,13-14,29H,6-7,9-12,15H2,1-2H3 |
| InChIKey | FJRDEWPRXJNSOJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|