C25H32ClN3O4 — CID 68862110
[3-[4-(4-aminobutyl)piperazin-1-yl]phenyl]methanol;6-chloro-2H-chromene-3-carboxylic acid (PubChem CID 68862110) has the molecular formula C25H32ClN3O4 and a molecular weight of 474.00 g/mol. Its IUPAC name is [3-[4-(4-aminobutyl)piperazin-1-yl]phenyl]methanol;6-chloro-2H-chromene-3-carboxylic acid.
| Compound Name | [3-[4-(4-aminobutyl)piperazin-1-yl]phenyl]methanol;6-chloro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 68862110 |
| Molecular Formula | C25H32ClN3O4 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | [3-[4-(4-aminobutyl)piperazin-1-yl]phenyl]methanol;6-chloro-2H-chromene-3-carboxylic acid |
| SMILES | NCCCCN1CCN(c2cccc(CO)c2)CC1.O=C(O)C1=Cc2cc(Cl)ccc2OC1 |
| InChI | InChI=1S/C15H25N3O.C10H7ClO3/c16-6-1-2-7-17-8-10-18(11-9-17)15-5-3-4-14(12-15)13-19;11-8-1-2-9-6(4-8)3-7(5-14-9)10(12)13/h3-5,12,19H,1-2,6-11,13,16H2;1-4H,5H2,(H,12,13) |
| InChIKey | HREWGWBGUYZLMM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|