C28H28N2O4S2 — CID 68864484
[5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1-benzothiophen-2-yl] N-prop-2-enylcarbamate (PubChem CID 68864484) has the molecular formula C28H28N2O4S2 and a molecular weight of 520.68 g/mol. Its IUPAC name is [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1-benzothiophen-2-yl] N-prop-2-enylcarbamate.
| Compound Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1-benzothiophen-2-yl] N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 68864484 |
| Molecular Formula | C28H28N2O4S2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | [5-[(4-tert-butylphenyl)sulfonylamino]-3-phenyl-1-benzothiophen-2-yl] N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)Oc1sc2ccc(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C28H28N2O4S2/c1-5-17-29-27(31)34-26-25(19-9-7-6-8-10-19)23-18-21(13-16-24(23)35-26)30-36(32,33)22-14-11-20(12-15-22)28(2,3)4/h5-16,18,30H,1,17H2,2-4H3,(H,29,31) |
| InChIKey | KRVBOSVPLBVLSH-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|