C29H33NO3S2 — CID 143364036
but-1-ene;4-tert-butyl-N-(2-formyl-3-phenyl-1-benzothiophen-5-yl)benzenesulfonamide;molecular hydrogen (PubChem CID 143364036) has the molecular formula C29H33NO3S2 and a molecular weight of 507.72 g/mol. Its IUPAC name is but-1-ene;4-tert-butyl-N-(2-formyl-3-phenyl-1-benzothiophen-5-yl)benzenesulfonamide;molecular hydrogen.
| Compound Name | but-1-ene;4-tert-butyl-N-(2-formyl-3-phenyl-1-benzothiophen-5-yl)benzenesulfonamide;molecular hydrogen |
|---|---|
| PubChem CID | 143364036 |
| Molecular Formula | C29H33NO3S2 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | but-1-ene;4-tert-butyl-N-(2-formyl-3-phenyl-1-benzothiophen-5-yl)benzenesulfonamide;molecular hydrogen |
| SMILES | C=CCC.CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3sc(C=O)c(-c4ccccc4)c3c2)cc1.[H][H] |
| InChI | InChI=1S/C25H23NO3S2.C4H8.H2/c1-25(2,3)18-9-12-20(13-10-18)31(28,29)26-19-11-14-22-21(15-19)24(23(16-27)30-22)17-7-5-4-6-8-17;1-3-4-2;/h4-16,26H,1-3H3;3H,1,4H2,2H3;1H |
| InChIKey | BMGHLQMCODZGAZ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|