C26H38O4Si — CID 68878307
cis-(1R,3S)-3-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methoxypropoxy]cyclohexan-1-ol (PubChem CID 68878307) has the molecular formula C26H38O4Si and a molecular weight of 442.67 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methoxypropoxy]cyclohexan-1-ol.
| Compound Name | cis-(1R,3S)-3-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methoxypropoxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 68878307 |
| Molecular Formula | C26H38O4Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | cis-(1R,3S)-3-[(2R)-3-[tert-butyl(diphenyl)silyl]oxy-2-methoxypropoxy]cyclohexan-1-ol |
| SMILES | CO[C@H](CO[C@H]1CCC[C@@H](O)C1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H38O4Si/c1-26(2,3)31(24-14-7-5-8-15-24,25-16-9-6-10-17-25)30-20-23(28-4)19-29-22-13-11-12-21(27)18-22/h5-10,14-17,21-23,27H,11-13,18-20H2,1-4H3/t21-,22+,23-/m1/s1 |
| InChIKey | KAHCLIOGUZERBY-XPWALMASSA-N |
| XLogP | 3.90 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|