C11H11ClFNO2 — CID 68908006
4-(3-chloropropyl)-8-fluoro-1,4-benzoxazin-3-one (PubChem CID 68908006) has the molecular formula C11H11ClFNO2 and a molecular weight of 243.66 g/mol. Its IUPAC name is 4-(3-chloropropyl)-8-fluoro-1,4-benzoxazin-3-one.
| Compound Name | 4-(3-chloropropyl)-8-fluoro-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 68908006 |
| Molecular Formula | C11H11ClFNO2 |
| Molecular Weight | 243.66 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 4-(3-chloropropyl)-8-fluoro-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2c(F)cccc2N1CCCCl |
| InChI | InChI=1S/C11H11ClFNO2/c12-5-2-6-14-9-4-1-3-8(13)11(9)16-7-10(14)15/h1,3-4H,2,5-7H2 |
| InChIKey | UWIMKJLIZIGFIN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|