About ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate
ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate (PubChem CID 68937693) has the molecular formula C23H25BrN2O2
and a molecular weight of 441.37 g/mol. Its IUPAC name is ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate |
| PubChem CID | 68937693 |
| Molecular Formula | C23H25BrN2O2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(Br)cccc2c1CCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C23H25BrN2O2/c1-2-28-23(27)22-18(17-10-5-12-19(24)21(17)25-22)11-7-15-26-14-6-9-16-8-3-4-13-20(16)26/h3-5,8,10,12-13,25H,2,6-7,9,11,14-15H2,1H3 |
| InChIKey | DFWJSIHOYIEPFN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate?
The IUPAC name of ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate (CID 68937693) is ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate.
What is the SMILES notation for ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate?
The canonical SMILES for ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate is CCOC(=O)c1[nH]c2c(Br)cccc2c1CCCN1CCCc2ccccc21.
What is the InChIKey of ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate?
The InChIKey is DFWJSIHOYIEPFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25BrN2O2/c1-2-28-23(27)22-18(17-10-5-12-19(24)21(17)25-22)11-7-15-26-14-6-9-16-8-3-4-13-20(16)26/h3-5,8,10,12-13,25H,2,6-7,9,11,14-15H2,1H3.
What are the key properties of ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate?
ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate has a molecular weight of 441.37 g/mol, XLogP of 5.49, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-bromo-3-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1H-indole-2-carboxylate is sourced from PubChem (CID 68937693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).