C20H25N3O2 — CID 69017224
[2-methyl-1-(6-phenyl-2-pyridinyl)propan-2-yl] piperazine-1-carboxylate (PubChem CID 69017224) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is [2-methyl-1-(6-phenyl-2-pyridinyl)propan-2-yl] piperazine-1-carboxylate.
| Compound Name | [2-methyl-1-(6-phenyl-2-pyridinyl)propan-2-yl] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69017224 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | [2-methyl-1-(6-phenyl-2-pyridinyl)propan-2-yl] piperazine-1-carboxylate |
| SMILES | CC(C)(Cc1cccc(-c2ccccc2)n1)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C20H25N3O2/c1-20(2,25-19(24)23-13-11-21-12-14-23)15-17-9-6-10-18(22-17)16-7-4-3-5-8-16/h3-10,21H,11-15H2,1-2H3 |
| InChIKey | AZZACALTSAVXHY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |