C22H23N3O5S2 — CID 69036537
5-benzoyl-2-[2-[(2-ethoxy-2-oxoethyl)amino]ethyl-sulfinoamino]-4-phenyl-1,3-thiazole (PubChem CID 69036537) has the molecular formula C22H23N3O5S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 5-benzoyl-2-[2-[(2-ethoxy-2-oxoethyl)amino]ethyl-sulfinoamino]-4-phenyl-1,3-thiazole.
| Compound Name | 5-benzoyl-2-[2-[(2-ethoxy-2-oxoethyl)amino]ethyl-sulfinoamino]-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 69036537 |
| Molecular Formula | C22H23N3O5S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 5-benzoyl-2-[2-[(2-ethoxy-2-oxoethyl)amino]ethyl-sulfinoamino]-4-phenyl-1,3-thiazole |
| SMILES | CCOC(=O)CNCCN(c1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1)S(=O)O |
| InChI | InChI=1S/C22H23N3O5S2/c1-2-30-18(26)15-23-13-14-25(32(28)29)22-24-19(16-9-5-3-6-10-16)21(31-22)20(27)17-11-7-4-8-12-17/h3-12,23H,2,13-15H2,1H3,(H,28,29) |
| InChIKey | YVTSWQHCTSHKQH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|