C24H29FN2O4 — CID 69059335
tert-butyl 4-[2-(4-fluoro-2-phenylmethoxyphenyl)-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 69059335) has the molecular formula C24H29FN2O4 and a molecular weight of 428.50 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-fluoro-2-phenylmethoxyphenyl)-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-fluoro-2-phenylmethoxyphenyl)-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69059335 |
| Molecular Formula | C24H29FN2O4 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | tert-butyl 4-[2-(4-fluoro-2-phenylmethoxyphenyl)-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(=O)c2ccc(F)cc2OCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H29FN2O4/c1-24(2,3)31-23(29)27-13-11-26(12-14-27)16-21(28)20-10-9-19(25)15-22(20)30-17-18-7-5-4-6-8-18/h4-10,15H,11-14,16-17H2,1-3H3 |
| InChIKey | AEEYIMJCIHZVED-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |