C17H13BrN2O4 — CID 69072127
5-bromo-2-N-(3-methoxyphenyl)-1-benzofuran-2,3-dicarboxamide (PubChem CID 69072127) has the molecular formula C17H13BrN2O4 and a molecular weight of 389.21 g/mol. Its IUPAC name is 5-bromo-2-N-(3-methoxyphenyl)-1-benzofuran-2,3-dicarboxamide.
| Compound Name | 5-bromo-2-N-(3-methoxyphenyl)-1-benzofuran-2,3-dicarboxamide |
|---|---|
| PubChem CID | 69072127 |
| Molecular Formula | C17H13BrN2O4 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 5-bromo-2-N-(3-methoxyphenyl)-1-benzofuran-2,3-dicarboxamide |
| SMILES | COc1cccc(NC(=O)c2oc3ccc(Br)cc3c2C(N)=O)c1 |
| InChI | InChI=1S/C17H13BrN2O4/c1-23-11-4-2-3-10(8-11)20-17(22)15-14(16(19)21)12-7-9(18)5-6-13(12)24-15/h2-8H,1H3,(H2,19,21)(H,20,22) |
| InChIKey | BSANRBZTBDYUFF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |