C8H11N3O3S — CID 69105960
4-(hydroxymethylamino)-1-(1,3-oxathiolan-5-yl)pyrimidin-2-one (PubChem CID 69105960) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 4-(hydroxymethylamino)-1-(1,3-oxathiolan-5-yl)pyrimidin-2-one.
| Compound Name | 4-(hydroxymethylamino)-1-(1,3-oxathiolan-5-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 69105960 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 4-(hydroxymethylamino)-1-(1,3-oxathiolan-5-yl)pyrimidin-2-one |
| SMILES | O=c1nc(NCO)ccn1C1CSCO1 |
| InChI | InChI=1S/C8H11N3O3S/c12-4-9-6-1-2-11(8(13)10-6)7-3-15-5-14-7/h1-2,7,12H,3-5H2,(H,9,10,13) |
| InChIKey | MKDOSUITUVLSEQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|