C9H9N3 — CID 69166639
1,2,3,4-tetrahydroquinoxaline-2-carbonitrile (PubChem CID 69166639) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroquinoxaline-2-carbonitrile.
| Compound Name | 1,2,3,4-tetrahydroquinoxaline-2-carbonitrile |
|---|---|
| PubChem CID | 69166639 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 1,2,3,4-tetrahydroquinoxaline-2-carbonitrile |
| SMILES | N#CC1CNc2ccccc2N1 |
| InChI | InChI=1S/C9H9N3/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7,11-12H,6H2 |
| InChIKey | LGABPYRQJXIQFT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|