C19H22FN3O — CID 69223014
N'-(3-amino-2-hydroxy-2,3-dihydro-1H-inden-5-yl)-N-[(4-fluorophenyl)methyl]-N-methylethanimidamide (PubChem CID 69223014) has the molecular formula C19H22FN3O and a molecular weight of 327.40 g/mol. Its IUPAC name is N'-(3-amino-2-hydroxy-2,3-dihydro-1H-inden-5-yl)-N-[(4-fluorophenyl)methyl]-N-methylethanimidamide.
| Compound Name | N'-(3-amino-2-hydroxy-2,3-dihydro-1H-inden-5-yl)-N-[(4-fluorophenyl)methyl]-N-methylethanimidamide |
|---|---|
| PubChem CID | 69223014 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N'-(3-amino-2-hydroxy-2,3-dihydro-1H-inden-5-yl)-N-[(4-fluorophenyl)methyl]-N-methylethanimidamide |
| SMILES | C/C(=N\c1ccc2c(c1)C(N)C(O)C2)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FN3O/c1-12(23(2)11-13-3-6-15(20)7-4-13)22-16-8-5-14-9-18(24)19(21)17(14)10-16/h3-8,10,18-19,24H,9,11,21H2,1-2H3/b22-12+ |
| InChIKey | DZCVVXFXPAMZBJ-WSDLNYQXSA-N |
| XLogP | 2.92 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|