C4H9N5 — CID 69238972
1-N-methylpyrazole-1,4,5-triamine (PubChem CID 69238972) has the molecular formula C4H9N5 and a molecular weight of 127.15 g/mol. Its IUPAC name is 1-N-methylpyrazole-1,4,5-triamine.
| Compound Name | 1-N-methylpyrazole-1,4,5-triamine |
|---|---|
| PubChem CID | 69238972 |
| Molecular Formula | C4H9N5 |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | 1-N-methylpyrazole-1,4,5-triamine |
| SMILES | CNn1ncc(N)c1N |
| InChI | InChI=1S/C4H9N5/c1-7-9-4(6)3(5)2-8-9/h2,7H,5-6H2,1H3 |
| InChIKey | QLHSJBUCDURMRF-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |