C35H33ClF3NO5 — CID 69253653
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]-3-methoxy-3-oxopropanoic acid (PubChem CID 69253653) has the molecular formula C35H33ClF3NO5 and a molecular weight of 640.10 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]-3-methoxy-3-oxopropanoic acid.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]-3-methoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 69253653 |
| Molecular Formula | C35H33ClF3NO5 |
| Molecular Weight | 640.10 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]-3-methoxy-3-oxopropanoic acid |
| SMILES | COC(=O)C(C(=O)O)c1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)C(C)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C35H33ClF3NO5/c1-34(26-14-5-3-6-15-26,27-16-7-4-8-17-27)40(23-25-13-10-19-29(31(25)36)35(37,38)39)20-11-21-45-28-18-9-12-24(22-28)30(32(41)42)33(43)44-2/h3-10,12-19,22,30H,11,20-21,23H2,1-2H3,(H,41,42) |
| InChIKey | DAUABLRQSDOVKL-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.10 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|