C36H38ClF3N2O3 — CID 69415239
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]-N-(2-methoxyethyl)acetamide (PubChem CID 69415239) has the molecular formula C36H38ClF3N2O3 and a molecular weight of 639.16 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 69415239 |
| Molecular Formula | C36H38ClF3N2O3 |
| Molecular Weight | 639.16 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)C(C)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C36H38ClF3N2O3/c1-35(29-14-5-3-6-15-29,30-16-7-4-8-17-30)42(26-28-13-10-19-32(34(28)37)36(38,39)40)21-11-22-45-31-18-9-12-27(24-31)25-33(43)41-20-23-44-2/h3-10,12-19,24H,11,20-23,25-26H2,1-2H3,(H,41,43) |
| InChIKey | GKMWVEYHXGZAGP-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.16 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|