C9H10N2S — CID 69328957
3-(1,3-thiazol-2-yl)hex-2-enenitrile (PubChem CID 69328957) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)hex-2-enenitrile.
| Compound Name | 3-(1,3-thiazol-2-yl)hex-2-enenitrile |
|---|---|
| PubChem CID | 69328957 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)hex-2-enenitrile |
| SMILES | CCCC(=CC#N)c1nccs1 |
| InChI | InChI=1S/C9H10N2S/c1-2-3-8(4-5-10)9-11-6-7-12-9/h4,6-7H,2-3H2,1H3 |
| InChIKey | DNXGVCKEQUDKAD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|