C18H25F2N3O2 — CID 69359439
tert-butyl (9R,13R)-4-(difluoromethyl)-5,13-dimethyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate (PubChem CID 69359439) has the molecular formula C18H25F2N3O2 and a molecular weight of 353.41 g/mol. Its IUPAC name is tert-butyl (9R,13R)-4-(difluoromethyl)-5,13-dimethyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate.
| Compound Name | tert-butyl (9R,13R)-4-(difluoromethyl)-5,13-dimethyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate |
|---|---|
| PubChem CID | 69359439 |
| Molecular Formula | C18H25F2N3O2 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | tert-butyl (9R,13R)-4-(difluoromethyl)-5,13-dimethyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate |
| SMILES | Cc1cc2c(nc1C(F)F)N1[C@H](C2)CN(C(=O)OC(C)(C)C)C[C@H]1C |
| InChI | InChI=1S/C18H25F2N3O2/c1-10-6-12-7-13-9-22(17(24)25-18(3,4)5)8-11(2)23(13)16(12)21-14(10)15(19)20/h6,11,13,15H,7-9H2,1-5H3/t11-,13-/m1/s1 |
| InChIKey | LDRKCHIMZFSSHP-DGCLKSJQSA-N |
| XLogP | 3.70 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |