C33H59N3O4Si2 — CID 67239093
tert-butyl (9R,13R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethenyl]-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate (PubChem CID 67239093) has the molecular formula C33H59N3O4Si2 and a molecular weight of 618.02 g/mol. Its IUPAC name is tert-butyl (9R,13R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethenyl]-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate.
| Compound Name | tert-butyl (9R,13R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethenyl]-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 67239093 |
| Molecular Formula | C33H59N3O4Si2 |
| Molecular Weight | 618.02 g/mol |
| Exact Mass | 617.40 |
| IUPAC Name | tert-butyl (9R,13R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethenyl]-4-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OCc1nc2c(cc1C=CO[Si](C)(C)C(C)(C)C)C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@@H](C)N21 |
| InChI | InChI=1S/C33H59N3O4Si2/c1-23(2)33(10,11)42(14,15)39-22-28-25(16-17-38-41(12,13)32(7,8)9)18-26-19-27-21-35(30(37)40-31(4,5)6)20-24(3)36(27)29(26)34-28/h16-18,23-24,27H,19-22H2,1-15H3/t24-,27-/m1/s1 |
| InChIKey | BDCYKQUJKGKQEB-SHQCIBLASA-N |
| XLogP | 8.60 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.02 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|