C25H43N3O4Si — CID 67237397
tert-butyl (9R,13R)-4-[2-[tert-butyl(dimethyl)silyl]oxy-1-methoxyethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate (PubChem CID 67237397) has the molecular formula C25H43N3O4Si and a molecular weight of 477.72 g/mol. Its IUPAC name is tert-butyl (9R,13R)-4-[2-[tert-butyl(dimethyl)silyl]oxy-1-methoxyethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate.
| Compound Name | tert-butyl (9R,13R)-4-[2-[tert-butyl(dimethyl)silyl]oxy-1-methoxyethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate |
|---|---|
| PubChem CID | 67237397 |
| Molecular Formula | C25H43N3O4Si |
| Molecular Weight | 477.72 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | tert-butyl (9R,13R)-4-[2-[tert-butyl(dimethyl)silyl]oxy-1-methoxyethyl]-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylate |
| SMILES | COC(CO[Si](C)(C)C(C)(C)C)c1ccc2c(n1)N1[C@H](C2)CN(C(=O)OC(C)(C)C)C[C@H]1C |
| InChI | InChI=1S/C25H43N3O4Si/c1-17-14-27(23(29)32-24(2,3)4)15-19-13-18-11-12-20(26-22(18)28(17)19)21(30-8)16-31-33(9,10)25(5,6)7/h11-12,17,19,21H,13-16H2,1-10H3/t17-,19-,21?/m1/s1 |
| InChIKey | MUDNINCUVZPEDU-ONTUJTEPSA-N |
| XLogP | 5.16 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.72 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|