C18H26BrN3O3 — CID 86596356
tert-butyl (9R,13R)-4-bromo-5-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate (PubChem CID 86596356) has the molecular formula C18H26BrN3O3 and a molecular weight of 412.33 g/mol. Its IUPAC name is tert-butyl (9R,13R)-4-bromo-5-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate.
| Compound Name | tert-butyl (9R,13R)-4-bromo-5-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 86596356 |
| Molecular Formula | C18H26BrN3O3 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | tert-butyl (9R,13R)-4-bromo-5-ethoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
| SMILES | CCOc1cc2c(nc1Br)N1[C@H](C2)CN(C(=O)OC(C)(C)C)C[C@H]1C |
| InChI | InChI=1S/C18H26BrN3O3/c1-6-24-14-8-12-7-13-10-21(17(23)25-18(3,4)5)9-11(2)22(13)16(12)20-15(14)19/h8,11,13H,6-7,9-10H2,1-5H3/t11-,13-/m1/s1 |
| InChIKey | OAYITTIHYNQFMC-DGCLKSJQSA-N |
| XLogP | 3.61 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|