C22H33N3O4 — CID 69360155
tert-butyl (9R,13R)-4-[cyclopropyl(methoxy)methyl]-5-methoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate (PubChem CID 69360155) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is tert-butyl (9R,13R)-4-[cyclopropyl(methoxy)methyl]-5-methoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate.
| Compound Name | tert-butyl (9R,13R)-4-[cyclopropyl(methoxy)methyl]-5-methoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 69360155 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | tert-butyl (9R,13R)-4-[cyclopropyl(methoxy)methyl]-5-methoxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
| SMILES | COc1cc2c(nc1C(OC)C1CC1)N1[C@H](C2)CN(C(=O)OC(C)(C)C)C[C@H]1C |
| InChI | InChI=1S/C22H33N3O4/c1-13-11-24(21(26)29-22(2,3)4)12-16-9-15-10-17(27-5)18(23-20(15)25(13)16)19(28-6)14-7-8-14/h10,13-14,16,19H,7-9,11-12H2,1-6H3/t13-,16-,19?/m1/s1 |
| InChIKey | YJHGNXOLISKBSU-ATSUZXQRSA-N |
| XLogP | 3.56 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |