C21H31N3O4 — CID 69357177
tert-butyl (9R,13R)-4-[cyclopropyl(methoxy)methyl]-5-hydroxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate (PubChem CID 69357177) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl (9R,13R)-4-[cyclopropyl(methoxy)methyl]-5-hydroxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate.
| Compound Name | tert-butyl (9R,13R)-4-[cyclopropyl(methoxy)methyl]-5-hydroxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 69357177 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl (9R,13R)-4-[cyclopropyl(methoxy)methyl]-5-hydroxy-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylate |
| SMILES | COC(c1nc2c(cc1O)C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@@H](C)N21)C1CC1 |
| InChI | InChI=1S/C21H31N3O4/c1-12-10-23(20(26)28-21(2,3)4)11-15-8-14-9-16(25)17(22-19(14)24(12)15)18(27-5)13-6-7-13/h9,12-13,15,18,25H,6-8,10-11H2,1-5H3/t12-,15-,18?/m1/s1 |
| InChIKey | LLDBNOXKKPWKNM-PYKVHREBSA-N |
| XLogP | 3.26 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |